C22H24F3N3O5S — CID 153485437
[(6'aR,7'R,10'aR)-7',10'a-dimethyl-2'-pyridin-4-ylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline]-4'-yl] trifluoromethanesulfonate (PubChem CID 153485437) has the molecular formula C22H24F3N3O5S and a molecular weight of 499.51 g/mol. Its IUPAC name is [(6'aR,7'R,10'aR)-7',10'a-dimethyl-2'-pyridin-4-ylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline]-4'-yl] trifluoromethanesulfonate.
| Compound Name | [(6'aR,7'R,10'aR)-7',10'a-dimethyl-2'-pyridin-4-ylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline]-4'-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 153485437 |
| Molecular Formula | C22H24F3N3O5S |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | [(6'aR,7'R,10'aR)-7',10'a-dimethyl-2'-pyridin-4-ylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline]-4'-yl] trifluoromethanesulfonate |
| SMILES | C[C@@H]1[C@H]2CCc3c(OS(=O)(=O)C(F)(F)F)nc(-c4ccncc4)nc3[C@]2(C)CCC12OCCO2 |
| InChI | InChI=1S/C22H24F3N3O5S/c1-13-16-4-3-15-17(20(16,2)7-8-21(13)31-11-12-32-21)27-18(14-5-9-26-10-6-14)28-19(15)33-34(29,30)22(23,24)25/h5-6,9-10,13,16H,3-4,7-8,11-12H2,1-2H3/t13-,16-,20-/m1/s1 |
| InChIKey | CIYZGCCNAREJIW-OWDMVUQNSA-N |
| XLogP | 3.76 |
| TPSA | 100.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|