C30H23FN4O — CID 153485508
(6aR,7R,10aS)-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-2-quinolin-5-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one (PubChem CID 153485508) has the molecular formula C30H23FN4O and a molecular weight of 474.54 g/mol. Its IUPAC name is (6aR,7R,10aS)-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-2-quinolin-5-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one.
| Compound Name | (6aR,7R,10aS)-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-2-quinolin-5-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 153485508 |
| Molecular Formula | C30H23FN4O |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | (6aR,7R,10aS)-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-2-quinolin-5-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)c3nc(-c4cccc5ncccc45)nc(-c4ccccc4F)c3CC[C@@H]2[C@@H](C)C1=O |
| InChI | InChI=1S/C30H23FN4O/c1-17-22-14-13-21-26(20-8-4-5-11-23(20)31)34-29(19-9-6-12-24-18(19)10-7-15-33-24)35-28(21)30(22,2)16-25(32-3)27(17)36/h4-12,15-17,22H,13-14H2,1-2H3/t17-,22-,30-/m1/s1 |
| InChIKey | AKGFAPNODWHBHS-GATQBYJTSA-N |
| XLogP | 6.34 |
| TPSA | 60.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|