C35H25FN4O — CID 153485534
(6aR,7R,10aS)-4-(2-fluorophenyl)-9-isocyano-7-methyl-10a-phenyl-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one (PubChem CID 153485534) has the molecular formula C35H25FN4O and a molecular weight of 536.61 g/mol. Its IUPAC name is (6aR,7R,10aS)-4-(2-fluorophenyl)-9-isocyano-7-methyl-10a-phenyl-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one.
| Compound Name | (6aR,7R,10aS)-4-(2-fluorophenyl)-9-isocyano-7-methyl-10a-phenyl-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 153485534 |
| Molecular Formula | C35H25FN4O |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | (6aR,7R,10aS)-4-(2-fluorophenyl)-9-isocyano-7-methyl-10a-phenyl-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one |
| SMILES | [C-]#[N+]C1=C[C@@]2(c3ccccc3)c3nc(-c4ccnc5ccccc45)nc(-c4ccccc4F)c3CC[C@@H]2[C@@H](C)C1=O |
| InChI | InChI=1S/C35H25FN4O/c1-21-27-17-16-26-31(25-13-6-8-14-28(25)36)39-34(24-18-19-38-29-15-9-7-12-23(24)29)40-33(26)35(27,20-30(37-2)32(21)41)22-10-4-3-5-11-22/h3-15,18-21,27H,16-17H2,1H3/t21-,27-,35+/m1/s1 |
| InChIKey | SFGPMRYKLOLHGO-UZRFSFEASA-N |
| XLogP | 7.37 |
| TPSA | 60.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|