C39H33N5O2 — CID 153485588
4-[(6aR,7R,10aS)-9-isocyano-7,10a-dimethyl-8-oxo-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-4-yl]-N-benzyl-N-methylbenzamide (PubChem CID 153485588) has the molecular formula C39H33N5O2 and a molecular weight of 603.73 g/mol. Its IUPAC name is 4-[(6aR,7R,10aS)-9-isocyano-7,10a-dimethyl-8-oxo-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-4-yl]-N-benzyl-N-methylbenzamide.
| Compound Name | 4-[(6aR,7R,10aS)-9-isocyano-7,10a-dimethyl-8-oxo-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-4-yl]-N-benzyl-N-methylbenzamide |
|---|---|
| PubChem CID | 153485588 |
| Molecular Formula | C39H33N5O2 |
| Molecular Weight | 603.73 g/mol |
| Exact Mass | 603.26 |
| IUPAC Name | 4-[(6aR,7R,10aS)-9-isocyano-7,10a-dimethyl-8-oxo-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-4-yl]-N-benzyl-N-methylbenzamide |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)c3nc(-c4ccnc5ccccc45)nc(-c4ccc(C(=O)N(C)Cc5ccccc5)cc4)c3CC[C@@H]2[C@@H](C)C1=O |
| InChI | InChI=1S/C39H33N5O2/c1-24-31-19-18-30-34(26-14-16-27(17-15-26)38(46)44(4)23-25-10-6-5-7-11-25)42-37(29-20-21-41-32-13-9-8-12-28(29)32)43-36(30)39(31,2)22-33(40-3)35(24)45/h5-17,20-22,24,31H,18-19,23H2,1-2,4H3/t24-,31-,39-/m1/s1 |
| InChIKey | IPFFEPDETCDCRO-MKHLZPEPSA-N |
| XLogP | 7.47 |
| TPSA | 80.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.73 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|