About 2-tert-butyl-7-[(1-tert-butylpiperidin-4-yl)methyl]-2,7-diazaspiro[4.4]nonane
2-tert-butyl-7-[(1-tert-butylpiperidin-4-yl)methyl]-2,7-diazaspiro[4.4]nonane (PubChem CID 153486094) has the molecular formula C21H41N3
and a molecular weight of 335.58 g/mol. Its IUPAC name is 2-tert-butyl-7-[(1-tert-butylpiperidin-4-yl)methyl]-2,7-diazaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 2-tert-butyl-7-[(1-tert-butylpiperidin-4-yl)methyl]-2,7-diazaspiro[4.4]nonane |
| PubChem CID | 153486094 |
| Molecular Formula | C21H41N3 |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.33 |
| IUPAC Name | 2-tert-butyl-7-[(1-tert-butylpiperidin-4-yl)methyl]-2,7-diazaspiro[4.4]nonane |
| SMILES | CC(C)(C)N1CCC(CN2CCC3(CCN(C(C)(C)C)C3)C2)CC1 |
| InChI | InChI=1S/C21H41N3/c1-19(2,3)23-11-7-18(8-12-23)15-22-13-9-21(16-22)10-14-24(17-21)20(4,5)6/h18H,7-17H2,1-6H3 |
| InChIKey | XTAKGILKQNKYGQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butyl-7-[(1-tert-butylpiperidin-4-yl)methyl]-2,7-diazaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-7-[(1-tert-butylpiperidin-4-yl)methyl]-2,7-diazaspiro[4.4]nonane?
The IUPAC name of 2-tert-butyl-7-[(1-tert-butylpiperidin-4-yl)methyl]-2,7-diazaspiro[4.4]nonane (CID 153486094) is 2-tert-butyl-7-[(1-tert-butylpiperidin-4-yl)methyl]-2,7-diazaspiro[4.4]nonane.
What is the SMILES notation for 2-tert-butyl-7-[(1-tert-butylpiperidin-4-yl)methyl]-2,7-diazaspiro[4.4]nonane?
The canonical SMILES for 2-tert-butyl-7-[(1-tert-butylpiperidin-4-yl)methyl]-2,7-diazaspiro[4.4]nonane is CC(C)(C)N1CCC(CN2CCC3(CCN(C(C)(C)C)C3)C2)CC1.
What is the InChIKey of 2-tert-butyl-7-[(1-tert-butylpiperidin-4-yl)methyl]-2,7-diazaspiro[4.4]nonane?
The InChIKey is XTAKGILKQNKYGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H41N3/c1-19(2,3)23-11-7-18(8-12-23)15-22-13-9-21(16-22)10-14-24(17-21)20(4,5)6/h18H,7-17H2,1-6H3.
What are the key properties of 2-tert-butyl-7-[(1-tert-butylpiperidin-4-yl)methyl]-2,7-diazaspiro[4.4]nonane?
2-tert-butyl-7-[(1-tert-butylpiperidin-4-yl)methyl]-2,7-diazaspiro[4.4]nonane has a molecular weight of 335.58 g/mol, XLogP of 3.69, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-7-[(1-tert-butylpiperidin-4-yl)methyl]-2,7-diazaspiro[4.4]nonane is sourced from PubChem (CID 153486094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).