C55H42N4O — CID 153486807
N-[(3Z)-1-amino-2-methylidenehexa-3,5-dienylidene]-N'-[[6'-(3-quinolin-8-ylphenyl)spiro[fluorene-9,9'-xanthene]-3'-yl]methyl]cyclohexa-1,5-diene-1-carboximidamide (PubChem CID 153486807) has the molecular formula C55H42N4O and a molecular weight of 774.97 g/mol. Its IUPAC name is N-[(3Z)-1-amino-2-methylidenehexa-3,5-dienylidene]-N'-[[6'-(3-quinolin-8-ylphenyl)spiro[fluorene-9,9'-xanthene]-3'-yl]methyl]cyclohexa-1,5-diene-1-carboximidamide.
| Compound Name | N-[(3Z)-1-amino-2-methylidenehexa-3,5-dienylidene]-N'-[[6'-(3-quinolin-8-ylphenyl)spiro[fluorene-9,9'-xanthene]-3'-yl]methyl]cyclohexa-1,5-diene-1-carboximidamide |
|---|---|
| PubChem CID | 153486807 |
| Molecular Formula | C55H42N4O |
| Molecular Weight | 774.97 g/mol |
| Exact Mass | 774.34 |
| IUPAC Name | N-[(3Z)-1-amino-2-methylidenehexa-3,5-dienylidene]-N'-[[6'-(3-quinolin-8-ylphenyl)spiro[fluorene-9,9'-xanthene]-3'-yl]methyl]cyclohexa-1,5-diene-1-carboximidamide |
| SMILES | C=C/C=C\C(=C)/C(N)=N/C(=N\Cc1ccc2c(c1)Oc1cc(-c3cccc(-c4cccc5cccnc45)c3)ccc1C21c2ccccc2-c2ccccc21)C1=CCCC=C1 |
| InChI | InChI=1S/C55H42N4O/c1-3-4-15-36(2)53(56)59-54(39-16-6-5-7-17-39)58-35-37-27-29-48-50(32-37)60-51-34-41(40-19-12-20-42(33-40)43-24-13-18-38-21-14-31-57-52(38)43)28-30-49(51)55(48)46-25-10-8-22-44(46)45-23-9-11-26-47(45)55/h3-4,6,8-34H,1-2,5,7,35H2,(H2,56,58,59)/b15-4- |
| InChIKey | UOGQUZDYZVHSEE-TVPGTPATSA-N |
| XLogP | 12.87 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.97 |
| LogP ≤ 5 | 12.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|