C21H38O2Si — CID 153487307
trans-(2Z,3S,4R)-3-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-3,4-dimethyl-2-prop-2-enylidenecyclohexan-1-one (PubChem CID 153487307) has the molecular formula C21H38O2Si and a molecular weight of 350.62 g/mol. Its IUPAC name is trans-(2Z,3S,4R)-3-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-3,4-dimethyl-2-prop-2-enylidenecyclohexan-1-one.
| Compound Name | trans-(2Z,3S,4R)-3-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-3,4-dimethyl-2-prop-2-enylidenecyclohexan-1-one |
|---|---|
| PubChem CID | 153487307 |
| Molecular Formula | C21H38O2Si |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | trans-(2Z,3S,4R)-3-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-3,4-dimethyl-2-prop-2-enylidenecyclohexan-1-one |
| SMILES | C=C/C=C1\C(=O)CC[C@@H](C)[C@]1(C)CCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38O2Si/c1-9-12-18-19(22)14-13-17(2)21(18,6)15-10-11-16-23-24(7,8)20(3,4)5/h9,12,17H,1,10-11,13-16H2,2-8H3/b18-12+/t17-,21+/m1/s1 |
| InChIKey | VOJJKLUEBIIASP-CAQXYLJISA-N |
| XLogP | 6.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|