About 5-cyclopropyl-2,4-dimethylpyrrolo[3,2-d]pyrimidine
5-cyclopropyl-2,4-dimethylpyrrolo[3,2-d]pyrimidine (PubChem CID 153487640) has the molecular formula C11H13N3
and a molecular weight of 187.25 g/mol. Its IUPAC name is 5-cyclopropyl-2,4-dimethylpyrrolo[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 5-cyclopropyl-2,4-dimethylpyrrolo[3,2-d]pyrimidine |
| PubChem CID | 153487640 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 5-cyclopropyl-2,4-dimethylpyrrolo[3,2-d]pyrimidine |
| SMILES | Cc1nc(C)c2c(ccn2C2CC2)n1 |
| InChI | InChI=1S/C11H13N3/c1-7-11-10(13-8(2)12-7)5-6-14(11)9-3-4-9/h5-6,9H,3-4H2,1-2H3 |
| InChIKey | RRFMMAMPVRBOQR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-cyclopropyl-2,4-dimethylpyrrolo[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-2,4-dimethylpyrrolo[3,2-d]pyrimidine?
The IUPAC name of 5-cyclopropyl-2,4-dimethylpyrrolo[3,2-d]pyrimidine (CID 153487640) is 5-cyclopropyl-2,4-dimethylpyrrolo[3,2-d]pyrimidine.
What is the SMILES notation for 5-cyclopropyl-2,4-dimethylpyrrolo[3,2-d]pyrimidine?
The canonical SMILES for 5-cyclopropyl-2,4-dimethylpyrrolo[3,2-d]pyrimidine is Cc1nc(C)c2c(ccn2C2CC2)n1.
What is the InChIKey of 5-cyclopropyl-2,4-dimethylpyrrolo[3,2-d]pyrimidine?
The InChIKey is RRFMMAMPVRBOQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3/c1-7-11-10(13-8(2)12-7)5-6-14(11)9-3-4-9/h5-6,9H,3-4H2,1-2H3.
What are the key properties of 5-cyclopropyl-2,4-dimethylpyrrolo[3,2-d]pyrimidine?
5-cyclopropyl-2,4-dimethylpyrrolo[3,2-d]pyrimidine has a molecular weight of 187.25 g/mol, XLogP of 2.38, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-2,4-dimethylpyrrolo[3,2-d]pyrimidine is sourced from PubChem (CID 153487640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).