C25H29F2NO9RfS2-2 — CID 153488051
2-[4-tert-butyl-5-oxo-2-(4-oxoadamantane-1-carbonyl)oxy-8-thia-4-azatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxy-1,1-difluoroethanesulfonate;rutherfordium (PubChem CID 153488051) has the molecular formula C25H29F2NO9RfS2-2 and a molecular weight of 856.63 g/mol. Its IUPAC name is 2-[4-tert-butyl-5-oxo-2-(4-oxoadamantane-1-carbonyl)oxy-8-thia-4-azatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxy-1,1-difluoroethanesulfonate;rutherfordium.
| Compound Name | 2-[4-tert-butyl-5-oxo-2-(4-oxoadamantane-1-carbonyl)oxy-8-thia-4-azatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxy-1,1-difluoroethanesulfonate;rutherfordium |
|---|---|
| PubChem CID | 153488051 |
| Molecular Formula | C25H29F2NO9RfS2-2 |
| Molecular Weight | 856.63 g/mol |
| Exact Mass | 856.25 |
| IUPAC Name | 2-[4-tert-butyl-5-oxo-2-(4-oxoadamantane-1-carbonyl)oxy-8-thia-4-azatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxy-1,1-difluoroethanesulfonate;rutherfordium |
| SMILES | CC(C)(C)N1C(=O)C2C3SC(C(OC(=O)C45CC6CC(C4)C(=O)C(C6)C5)C31)C2C(=O)O[CH-]C(F)(F)S(=O)(=O)[O-].[Rf] |
| InChI | InChI=1S/C25H30F2NO9S2.Rf/c1-23(2,3)28-15-17(37-22(32)24-6-10-4-11(7-24)16(29)12(5-10)8-24)19-14(13(20(28)30)18(15)38-19)21(31)36-9-25(26,27)39(33,34)35;/h9-15,17-19H,4-8H2,1-3H3,(H,33,34,35);/q-1;/p-1 |
| InChIKey | IEDAEUOBRMPPRU-UHFFFAOYSA-M |
| XLogP | 1.88 |
| TPSA | 147.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.63 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|