C22H25N7OS — CID 153488278
2-methyl-N-[4-[2,2,2-tri(pyrazol-1-yl)ethoxymethyl]phenyl]propanethioamide (PubChem CID 153488278) has the molecular formula C22H25N7OS and a molecular weight of 435.56 g/mol. Its IUPAC name is 2-methyl-N-[4-[2,2,2-tri(pyrazol-1-yl)ethoxymethyl]phenyl]propanethioamide.
| Compound Name | 2-methyl-N-[4-[2,2,2-tri(pyrazol-1-yl)ethoxymethyl]phenyl]propanethioamide |
|---|---|
| PubChem CID | 153488278 |
| Molecular Formula | C22H25N7OS |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 2-methyl-N-[4-[2,2,2-tri(pyrazol-1-yl)ethoxymethyl]phenyl]propanethioamide |
| SMILES | CC(C)C(=S)Nc1ccc(COCC(n2cccn2)(n2cccn2)n2cccn2)cc1 |
| InChI | InChI=1S/C22H25N7OS/c1-18(2)21(31)26-20-8-6-19(7-9-20)16-30-17-22(27-13-3-10-23-27,28-14-4-11-24-28)29-15-5-12-25-29/h3-15,18H,16-17H2,1-2H3,(H,26,31) |
| InChIKey | BOFNDQLHSSTHMC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 74.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|