C27H38N2O3Si2 — CID 15348921
(4S)-3-[(3S,4R)-1-[bis(trimethylsilyl)methyl]-2-oxo-4-(2-phenylethyl)azetidin-3-yl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 15348921) has the molecular formula C27H38N2O3Si2 and a molecular weight of 494.78 g/mol. Its IUPAC name is (4S)-3-[(3S,4R)-1-[bis(trimethylsilyl)methyl]-2-oxo-4-(2-phenylethyl)azetidin-3-yl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(3S,4R)-1-[bis(trimethylsilyl)methyl]-2-oxo-4-(2-phenylethyl)azetidin-3-yl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 15348921 |
| Molecular Formula | C27H38N2O3Si2 |
| Molecular Weight | 494.78 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | (4S)-3-[(3S,4R)-1-[bis(trimethylsilyl)methyl]-2-oxo-4-(2-phenylethyl)azetidin-3-yl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | C[Si](C)(C)C(N1C(=O)[C@@H](N2C(=O)OC[C@@H]2c2ccccc2)[C@H]1CCc1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C27H38N2O3Si2/c1-33(2,3)27(34(4,5)6)29-22(18-17-20-13-9-7-10-14-20)24(25(29)30)28-23(19-32-26(28)31)21-15-11-8-12-16-21/h7-16,22-24,27H,17-19H2,1-6H3/t22-,23-,24+/m1/s1 |
| InChIKey | DWDIMJQMLSUTGH-SMIHKQSGSA-N |
| XLogP | 5.52 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.78 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|