C32H32N6OZn2+2 — CID 153490041
zinc;2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenol;zinc (PubChem CID 153490041) has the molecular formula C32H32N6OZn2+2 and a molecular weight of 647.43 g/mol. Its IUPAC name is zinc;2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenol;zinc.
| Compound Name | zinc;2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenol;zinc |
|---|---|
| PubChem CID | 153490041 |
| Molecular Formula | C32H32N6OZn2+2 |
| Molecular Weight | 647.43 g/mol |
| Exact Mass | 644.12 |
| IUPAC Name | zinc;2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenol;zinc |
| SMILES | Oc1c(CN(Cc2ccccn2)Cc2ccccn2)cccc1CN(Cc1ccccn1)Cc1ccccn1.[Zn+2].[Zn] |
| InChI | InChI=1S/C32H32N6O.2Zn/c39-32-26(20-37(22-28-12-1-5-16-33-28)23-29-13-2-6-17-34-29)10-9-11-27(32)21-38(24-30-14-3-7-18-35-30)25-31-15-4-8-19-36-31;;/h1-19,39H,20-25H2;;/q;;+2 |
| InChIKey | DPYPYBVYXJKORK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.43 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|