About CID 153490146
CID 153490146 (PubChem CID 153490146) has the molecular formula C48H44IrN2O2S-2
and a molecular weight of 915.24 g/mol.
Molecular Properties
| Compound Name | CID 153490146 |
| PubChem CID | 153490146 |
| Molecular Formula | C48H44IrN2O2S-2 |
| Molecular Weight | 915.24 g/mol |
| Exact Mass | 915.34 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2c3cc(C([2H])([2H])[2H])c3oc4c5ccccc5sc4c32)cc1C([2H])([2H])C(C)(C)C.[2H]C([2H])(c1ccc(-c2[c-]cccc2)nc1)C(C)(C)C.[Ir] |
| InChI | InChI=1S/C32H26NO2S.C16H18N.Ir/c1-17-13-23-20-10-8-11-21(24-14-19(15-32(3,4)5)18(2)16-33-24)28(20)35-29(23)26-27(17)34-30-22-9-6-7-12-25(22)36-31(26)30;1-16(2,3)11-13-9-10-15(17-12-13)14-7-5-4-6-8-14;/h6-10,12-14,16H,15H2,1-5H3;4-7,9-10,12H,11H2,1-3H3;/q2*-1;/i1D3,2D3,15D2;11D2; |
| InChIKey | OZDBZDNXJKRQHC-QGIWTIQSSA-N |
| XLogP | 13.90 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 915.24 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 153490146 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153490146?
The IUPAC name of CID 153490146 (CID 153490146) is not available.
What is the SMILES notation for CID 153490146?
The canonical SMILES for CID 153490146 is [2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2c3cc(C([2H])([2H])[2H])c3oc4c5ccccc5sc4c32)cc1C([2H])([2H])C(C)(C)C.[2H]C([2H])(c1ccc(-c2[c-]cccc2)nc1)C(C)(C)C.[Ir].
What is the InChIKey of CID 153490146?
The InChIKey is OZDBZDNXJKRQHC-QGIWTIQSSA-N. The full InChI is InChI=1S/C32H26NO2S.C16H18N.Ir/c1-17-13-23-20-10-8-11-21(24-14-19(15-32(3,4)5)18(2)16-33-24)28(20)35-29(23)26-27(17)34-30-22-9-6-7-12-25(22)36-31(26)30;1-16(2,3)11-13-9-10-15(17-12-13)14-7-5-4-6-8-14;/h6-10,12-14,16H,15H2,1-5H3;4-7,9-10,12H,11H2,1-3H3;/q2*-1;/i1D3,2D3,15D2;11D2;.
What are the key properties of CID 153490146?
CID 153490146 has a molecular weight of 915.24 g/mol, XLogP of 13.90, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153490146 is sourced from PubChem (CID 153490146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).