About CID 153490153
CID 153490153 (PubChem CID 153490153) has the molecular formula C54H56IrN2O2S-2
and a molecular weight of 1004.43 g/mol.
Molecular Properties
| Compound Name | CID 153490153 |
| PubChem CID | 153490153 |
| Molecular Formula | C54H56IrN2O2S-2 |
| Molecular Weight | 1004.43 g/mol |
| Exact Mass | 1004.46 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2cc(C([2H])([2H])C(C)(C)C)c(C([2H])([2H])C(C)(C)C)cn2)cc1.[2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2c3cc(C([2H])([2H])[2H])c3oc4c5ccccc5sc4c32)cc1C([2H])([2H])C(C)(C)C.[Ir] |
| InChI | InChI=1S/C32H26NO2S.C22H30N.Ir/c1-17-13-23-20-10-8-11-21(24-14-19(15-32(3,4)5)18(2)16-33-24)28(20)35-29(23)26-27(17)34-30-22-9-6-7-12-25(22)36-31(26)30;1-16-8-10-17(11-9-16)20-12-18(13-21(2,3)4)19(15-23-20)14-22(5,6)7;/h6-10,12-14,16H,15H2,1-5H3;8-10,12,15H,13-14H2,1-7H3;/q2*-1;/i1D3,2D3,15D2;1D3,13D2,14D2; |
| InChIKey | NFSVOBSUBPVCCD-UZLCZUQTSA-N |
| XLogP | 15.80 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1004.43 |
| LogP ≤ 5 | 15.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 153490153 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153490153?
The IUPAC name of CID 153490153 (CID 153490153) is not available.
What is the SMILES notation for CID 153490153?
The canonical SMILES for CID 153490153 is [2H]C([2H])([2H])c1c[c-]c(-c2cc(C([2H])([2H])C(C)(C)C)c(C([2H])([2H])C(C)(C)C)cn2)cc1.[2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2c3cc(C([2H])([2H])[2H])c3oc4c5ccccc5sc4c32)cc1C([2H])([2H])C(C)(C)C.[Ir].
What is the InChIKey of CID 153490153?
The InChIKey is NFSVOBSUBPVCCD-UZLCZUQTSA-N. The full InChI is InChI=1S/C32H26NO2S.C22H30N.Ir/c1-17-13-23-20-10-8-11-21(24-14-19(15-32(3,4)5)18(2)16-33-24)28(20)35-29(23)26-27(17)34-30-22-9-6-7-12-25(22)36-31(26)30;1-16-8-10-17(11-9-16)20-12-18(13-21(2,3)4)19(15-23-20)14-22(5,6)7;/h6-10,12-14,16H,15H2,1-5H3;8-10,12,15H,13-14H2,1-7H3;/q2*-1;/i1D3,2D3,15D2;1D3,13D2,14D2;.
What are the key properties of CID 153490153?
CID 153490153 has a molecular weight of 1004.43 g/mol, XLogP of 15.80, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153490153 is sourced from PubChem (CID 153490153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).