About CID 153490162
CID 153490162 (PubChem CID 153490162) has the molecular formula C53H54IrN2O2S-2
and a molecular weight of 987.38 g/mol.
Molecular Properties
| Compound Name | CID 153490162 |
| PubChem CID | 153490162 |
| Molecular Formula | C53H54IrN2O2S-2 |
| Molecular Weight | 987.38 g/mol |
| Exact Mass | 987.43 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2c3cc(C([2H])([2H])[2H])c3oc4c5ccccc5sc4c32)cc1C([2H])([2H])C(C)(C)C.[2H]C([2H])(c1cnc(-c2[c-]cccc2)cc1C([2H])([2H])C(C)(C)C)C(C)(C)C.[Ir] |
| InChI | InChI=1S/C32H26NO2S.C21H28N.Ir/c1-17-13-23-20-10-8-11-21(24-14-19(15-32(3,4)5)18(2)16-33-24)28(20)35-29(23)26-27(17)34-30-22-9-6-7-12-25(22)36-31(26)30;1-20(2,3)13-17-12-19(16-10-8-7-9-11-16)22-15-18(17)14-21(4,5)6;/h6-10,12-14,16H,15H2,1-5H3;7-10,12,15H,13-14H2,1-6H3;/q2*-1;/i1D3,2D3,15D2;13D2,14D2; |
| InChIKey | YRCSVDCWICRUSG-CMJDBGPDSA-N |
| XLogP | 15.49 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 987.38 |
| LogP ≤ 5 | 15.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 153490162 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153490162?
The IUPAC name of CID 153490162 (CID 153490162) is not available.
What is the SMILES notation for CID 153490162?
The canonical SMILES for CID 153490162 is [2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2c3cc(C([2H])([2H])[2H])c3oc4c5ccccc5sc4c32)cc1C([2H])([2H])C(C)(C)C.[2H]C([2H])(c1cnc(-c2[c-]cccc2)cc1C([2H])([2H])C(C)(C)C)C(C)(C)C.[Ir].
What is the InChIKey of CID 153490162?
The InChIKey is YRCSVDCWICRUSG-CMJDBGPDSA-N. The full InChI is InChI=1S/C32H26NO2S.C21H28N.Ir/c1-17-13-23-20-10-8-11-21(24-14-19(15-32(3,4)5)18(2)16-33-24)28(20)35-29(23)26-27(17)34-30-22-9-6-7-12-25(22)36-31(26)30;1-20(2,3)13-17-12-19(16-10-8-7-9-11-16)22-15-18(17)14-21(4,5)6;/h6-10,12-14,16H,15H2,1-5H3;7-10,12,15H,13-14H2,1-6H3;/q2*-1;/i1D3,2D3,15D2;13D2,14D2;.
What are the key properties of CID 153490162?
CID 153490162 has a molecular weight of 987.38 g/mol, XLogP of 15.49, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153490162 is sourced from PubChem (CID 153490162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).