C12H18N4O8 — CID 153490177
1-[2-(dihydroxyamino)oxy-3-hydroxypropyl]-3-(oxiran-2-ylmethyl)-5-prop-2-enyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 153490177) has the molecular formula C12H18N4O8 and a molecular weight of 346.30 g/mol. Its IUPAC name is 1-[2-(dihydroxyamino)oxy-3-hydroxypropyl]-3-(oxiran-2-ylmethyl)-5-prop-2-enyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[2-(dihydroxyamino)oxy-3-hydroxypropyl]-3-(oxiran-2-ylmethyl)-5-prop-2-enyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 153490177 |
| Molecular Formula | C12H18N4O8 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 1-[2-(dihydroxyamino)oxy-3-hydroxypropyl]-3-(oxiran-2-ylmethyl)-5-prop-2-enyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(CC2CO2)c(=O)n(CC(CO)ON(O)O)c1=O |
| InChI | InChI=1S/C12H18N4O8/c1-2-3-13-10(18)14(4-8(6-17)24-16(21)22)12(20)15(11(13)19)5-9-7-23-9/h2,8-9,17,21-22H,1,3-7H2 |
| InChIKey | GFEDZSRTULRSJQ-UHFFFAOYSA-N |
| XLogP | -2.87 |
| TPSA | 151.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|