C12H8N4Se2 — CID 153490227
5,10-dimethyl-[1,2,3]benzoselenadiazolo[5,4-e][1,2,3]benzoselenadiazole (PubChem CID 153490227) has the molecular formula C12H8N4Se2 and a molecular weight of 366.14 g/mol. Its IUPAC name is 5,10-dimethyl-[1,2,3]benzoselenadiazolo[5,4-e][1,2,3]benzoselenadiazole.
| Compound Name | 5,10-dimethyl-[1,2,3]benzoselenadiazolo[5,4-e][1,2,3]benzoselenadiazole |
|---|---|
| PubChem CID | 153490227 |
| Molecular Formula | C12H8N4Se2 |
| Molecular Weight | 366.14 g/mol |
| Exact Mass | 367.91 |
| IUPAC Name | 5,10-dimethyl-[1,2,3]benzoselenadiazolo[5,4-e][1,2,3]benzoselenadiazole |
| SMILES | Cc1cc2c(cc(C)c3[se]nnc32)c2nn[se]c12 |
| InChI | InChI=1S/C12H8N4Se2/c1-5-3-7-8(9-11(5)17-15-13-9)4-6(2)12-10(7)14-16-18-12/h3-4H,1-2H3 |
| InChIKey | RGEHGAXLHMAIRM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.14 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|