C17H34CuN4-4 — CID 153490885
copper-64;trans-(7S,14S)-2,5,5,7,12,12,14-heptamethyl-1,4,8,11-tetrazanidacyclotetradecane (PubChem CID 153490885) has the molecular formula C17H34CuN4-4 and a molecular weight of 358.42 g/mol. Its IUPAC name is copper-64;trans-(7S,14S)-2,5,5,7,12,12,14-heptamethyl-1,4,8,11-tetrazanidacyclotetradecane.
| Compound Name | copper-64;trans-(7S,14S)-2,5,5,7,12,12,14-heptamethyl-1,4,8,11-tetrazanidacyclotetradecane |
|---|---|
| PubChem CID | 153490885 |
| Molecular Formula | C17H34CuN4-4 |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | copper-64;trans-(7S,14S)-2,5,5,7,12,12,14-heptamethyl-1,4,8,11-tetrazanidacyclotetradecane |
| SMILES | CC1C[N-]C(C)(C)C[C@H](C)[N-]CC[N-]C(C)(C)C[C@H](C)[N-]1.[64Cu] |
| InChI | InChI=1S/C17H34N4.Cu/c1-13-10-17(6,7)20-12-15(3)21-14(2)11-16(4,5)19-9-8-18-13;/h13-15H,8-12H2,1-7H3;/q-4;/t13-,14-,15?;/m0./s1/i;1+0 |
| InChIKey | RNMCEZRCVPJYGB-LLMPGSTISA-N |
| XLogP | 5.00 |
| TPSA | 56.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |