C32H48O — CID 15349299
2,2-bis[2,4,6-tri(propan-2-yl)phenyl]ethenol (PubChem CID 15349299) has the molecular formula C32H48O and a molecular weight of 448.74 g/mol. Its IUPAC name is 2,2-bis[2,4,6-tri(propan-2-yl)phenyl]ethenol.
| Compound Name | 2,2-bis[2,4,6-tri(propan-2-yl)phenyl]ethenol |
|---|---|
| PubChem CID | 15349299 |
| Molecular Formula | C32H48O |
| Molecular Weight | 448.74 g/mol |
| Exact Mass | 448.37 |
| IUPAC Name | 2,2-bis[2,4,6-tri(propan-2-yl)phenyl]ethenol |
| SMILES | CC(C)c1cc(C(C)C)c(C(=CO)c2c(C(C)C)cc(C(C)C)cc2C(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C32H48O/c1-18(2)24-13-26(20(5)6)31(27(14-24)21(7)8)30(17-33)32-28(22(9)10)15-25(19(3)4)16-29(32)23(11)12/h13-23,33H,1-12H3 |
| InChIKey | XYIJDZURWHLHBU-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.74 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|