C32H30IrN2O-2 — CID 153493010
2-(3-cyclopentylbenzene-6-id-1-yl)-4-propan-2-ylpyridine;iridium;3-phenyl-1,2-benzoxazole (PubChem CID 153493010) has the molecular formula C32H30IrN2O-2 and a molecular weight of 650.82 g/mol. Its IUPAC name is 2-(3-cyclopentylbenzene-6-id-1-yl)-4-propan-2-ylpyridine;iridium;3-phenyl-1,2-benzoxazole.
| Compound Name | 2-(3-cyclopentylbenzene-6-id-1-yl)-4-propan-2-ylpyridine;iridium;3-phenyl-1,2-benzoxazole |
|---|---|
| PubChem CID | 153493010 |
| Molecular Formula | C32H30IrN2O-2 |
| Molecular Weight | 650.82 g/mol |
| Exact Mass | 651.20 |
| IUPAC Name | 2-(3-cyclopentylbenzene-6-id-1-yl)-4-propan-2-ylpyridine;iridium;3-phenyl-1,2-benzoxazole |
| SMILES | CC(C)c1ccnc(-c2[c-]ccc(C3CCCC3)c2)c1.[Ir].[c-]1ccccc1-c1noc2ccccc12 |
| InChI | InChI=1S/C19H22N.C13H8NO.Ir/c1-14(2)16-10-11-20-19(13-16)18-9-5-8-17(12-18)15-6-3-4-7-15;1-2-6-10(7-3-1)13-11-8-4-5-9-12(11)15-14-13;/h5,8,10-15H,3-4,6-7H2,1-2H3;1-6,8-9H;/q2*-1; |
| InChIKey | VJWJRYYRVSHPJC-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.82 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|