C38H29IrN3O-2 — CID 153493051
iridium;2-phenyl-4-pyridin-3-ylpyridine;3-[3-(4-propan-2-ylphenyl)benzene-6-id-1-yl]-1,2-benzoxazole (PubChem CID 153493051) has the molecular formula C38H29IrN3O-2 and a molecular weight of 735.89 g/mol. Its IUPAC name is iridium;2-phenyl-4-pyridin-3-ylpyridine;3-[3-(4-propan-2-ylphenyl)benzene-6-id-1-yl]-1,2-benzoxazole.
| Compound Name | iridium;2-phenyl-4-pyridin-3-ylpyridine;3-[3-(4-propan-2-ylphenyl)benzene-6-id-1-yl]-1,2-benzoxazole |
|---|---|
| PubChem CID | 153493051 |
| Molecular Formula | C38H29IrN3O-2 |
| Molecular Weight | 735.89 g/mol |
| Exact Mass | 736.20 |
| IUPAC Name | iridium;2-phenyl-4-pyridin-3-ylpyridine;3-[3-(4-propan-2-ylphenyl)benzene-6-id-1-yl]-1,2-benzoxazole |
| SMILES | CC(C)c1ccc(-c2cc[c-]c(-c3noc4ccccc34)c2)cc1.[Ir].[c-]1ccccc1-c1cc(-c2cccnc2)ccn1 |
| InChI | InChI=1S/C22H18NO.C16H11N2.Ir/c1-15(2)16-10-12-17(13-11-16)18-6-5-7-19(14-18)22-20-8-3-4-9-21(20)24-23-22;1-2-5-13(6-3-1)16-11-14(8-10-18-16)15-7-4-9-17-12-15;/h3-6,8-15H,1-2H3;1-5,7-12H;/q2*-1; |
| InChIKey | RULIBJBOTYPTNI-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.89 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|