C38H31F3IrN2O2-2 — CID 153493074
2-(8-butoxy-9,9-dimethyl-2H-fluoren-2-id-1-yl)pyridine;iridium;3-[4-(trifluoromethyl)benzene-6-id-1-yl]-1,2-benzoxazole (PubChem CID 153493074) has the molecular formula C38H31F3IrN2O2-2 and a molecular weight of 796.89 g/mol. Its IUPAC name is 2-(8-butoxy-9,9-dimethyl-2H-fluoren-2-id-1-yl)pyridine;iridium;3-[4-(trifluoromethyl)benzene-6-id-1-yl]-1,2-benzoxazole.
| Compound Name | 2-(8-butoxy-9,9-dimethyl-2H-fluoren-2-id-1-yl)pyridine;iridium;3-[4-(trifluoromethyl)benzene-6-id-1-yl]-1,2-benzoxazole |
|---|---|
| PubChem CID | 153493074 |
| Molecular Formula | C38H31F3IrN2O2-2 |
| Molecular Weight | 796.89 g/mol |
| Exact Mass | 797.20 |
| IUPAC Name | 2-(8-butoxy-9,9-dimethyl-2H-fluoren-2-id-1-yl)pyridine;iridium;3-[4-(trifluoromethyl)benzene-6-id-1-yl]-1,2-benzoxazole |
| SMILES | CCCCOc1cccc2c1C(C)(C)c1c(-c3ccccn3)[c-]ccc1-2.FC(F)(F)c1c[c-]c(-c2noc3ccccc23)cc1.[Ir] |
| InChI | InChI=1S/C24H24NO.C14H7F3NO.Ir/c1-4-5-16-26-21-14-9-11-18-17-10-8-12-19(20-13-6-7-15-25-20)22(17)24(2,3)23(18)21;15-14(16,17)10-7-5-9(6-8-10)13-11-3-1-2-4-12(11)19-18-13;/h6-11,13-15H,4-5,16H2,1-3H3;1-5,7-8H;/q2*-1; |
| InChIKey | XRBBYNBNJQHJNH-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.89 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|