C42H28IrN2O2-2 — CID 153493101
3-(3-dibenzofuran-4-ylbenzene-6-id-1-yl)-1,2-benzoxazole;1-(3,5-dimethylbenzene-6-id-1-yl)isoquinoline;iridium (PubChem CID 153493101) has the molecular formula C42H28IrN2O2-2 and a molecular weight of 784.92 g/mol. Its IUPAC name is 3-(3-dibenzofuran-4-ylbenzene-6-id-1-yl)-1,2-benzoxazole;1-(3,5-dimethylbenzene-6-id-1-yl)isoquinoline;iridium.
| Compound Name | 3-(3-dibenzofuran-4-ylbenzene-6-id-1-yl)-1,2-benzoxazole;1-(3,5-dimethylbenzene-6-id-1-yl)isoquinoline;iridium |
|---|---|
| PubChem CID | 153493101 |
| Molecular Formula | C42H28IrN2O2-2 |
| Molecular Weight | 784.92 g/mol |
| Exact Mass | 785.18 |
| IUPAC Name | 3-(3-dibenzofuran-4-ylbenzene-6-id-1-yl)-1,2-benzoxazole;1-(3,5-dimethylbenzene-6-id-1-yl)isoquinoline;iridium |
| SMILES | Cc1[c-]c(-c2nccc3ccccc23)cc(C)c1.[Ir].[c-]1ccc(-c2cccc3c2oc2ccccc23)cc1-c1noc2ccccc12 |
| InChI | InChI=1S/C25H14NO2.C17H14N.Ir/c1-3-13-22-19(9-1)20-12-6-11-18(25(20)27-22)16-7-5-8-17(15-16)24-21-10-2-4-14-23(21)28-26-24;1-12-9-13(2)11-15(10-12)17-16-6-4-3-5-14(16)7-8-18-17;/h1-7,9-15H;3-10H,1-2H3;/q2*-1; |
| InChIKey | HJRPJKSQLPPKFO-UHFFFAOYSA-N |
| XLogP | 11.18 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.92 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|