C11H17NO4 — CID 15349320
methyl (2R,3R,3aR)-3-acetyl-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine-2-carboxylate (PubChem CID 15349320) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is methyl (2R,3R,3aR)-3-acetyl-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine-2-carboxylate.
| Compound Name | methyl (2R,3R,3aR)-3-acetyl-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 15349320 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | methyl (2R,3R,3aR)-3-acetyl-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1ON2CCCC[C@@H]2[C@H]1C(C)=O |
| InChI | InChI=1S/C11H17NO4/c1-7(13)9-8-5-3-4-6-12(8)16-10(9)11(14)15-2/h8-10H,3-6H2,1-2H3/t8-,9-,10-/m1/s1 |
| InChIKey | OTNFZCVVMPFRCD-OPRDCNLKSA-N |
| XLogP | 0.53 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |