C34H23ClF2N4O4 — CID 153494012
methyl (2S)-3-[8-(2-chloro-4-isocyanophenyl)quinolin-5-yl]-2-[[2,6-difluoro-4-(phenylcarbamoyl)benzoyl]amino]propanoate (PubChem CID 153494012) has the molecular formula C34H23ClF2N4O4 and a molecular weight of 625.03 g/mol. Its IUPAC name is methyl (2S)-3-[8-(2-chloro-4-isocyanophenyl)quinolin-5-yl]-2-[[2,6-difluoro-4-(phenylcarbamoyl)benzoyl]amino]propanoate.
| Compound Name | methyl (2S)-3-[8-(2-chloro-4-isocyanophenyl)quinolin-5-yl]-2-[[2,6-difluoro-4-(phenylcarbamoyl)benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 153494012 |
| Molecular Formula | C34H23ClF2N4O4 |
| Molecular Weight | 625.03 g/mol |
| Exact Mass | 624.14 |
| IUPAC Name | methyl (2S)-3-[8-(2-chloro-4-isocyanophenyl)quinolin-5-yl]-2-[[2,6-difluoro-4-(phenylcarbamoyl)benzoyl]amino]propanoate |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(C[C@H](NC(=O)c3c(F)cc(C(=O)Nc4ccccc4)cc3F)C(=O)OC)c3cccnc23)c(Cl)c1 |
| InChI | InChI=1S/C34H23ClF2N4O4/c1-38-22-11-13-24(26(35)18-22)25-12-10-19(23-9-6-14-39-31(23)25)17-29(34(44)45-2)41-33(43)30-27(36)15-20(16-28(30)37)32(42)40-21-7-4-3-5-8-21/h3-16,18,29H,17H2,2H3,(H,40,42)(H,41,43)/t29-/m0/s1 |
| InChIKey | XTOYOXZLDRYCSG-LJAQVGFWSA-N |
| XLogP | 7.15 |
| TPSA | 101.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.03 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|