C24H35BN2O6 — CID 153494059
(2R,5S)-3,6-dimethoxy-2-propan-2-yl-5-[[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]methyl]-2,5-dihydropyrazine (PubChem CID 153494059) has the molecular formula C24H35BN2O6 and a molecular weight of 458.36 g/mol. Its IUPAC name is (2R,5S)-3,6-dimethoxy-2-propan-2-yl-5-[[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]methyl]-2,5-dihydropyrazine.
| Compound Name | (2R,5S)-3,6-dimethoxy-2-propan-2-yl-5-[[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]methyl]-2,5-dihydropyrazine |
|---|---|
| PubChem CID | 153494059 |
| Molecular Formula | C24H35BN2O6 |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | (2R,5S)-3,6-dimethoxy-2-propan-2-yl-5-[[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]methyl]-2,5-dihydropyrazine |
| SMILES | COC1=N[C@H](C(C)C)C(OC)=N[C@H]1Cc1ccc(B2OC(C)(C)C(C)(C)O2)c2c1OCCO2 |
| InChI | InChI=1S/C24H35BN2O6/c1-14(2)18-22(29-8)26-17(21(27-18)28-7)13-15-9-10-16(20-19(15)30-11-12-31-20)25-32-23(3,4)24(5,6)33-25/h9-10,14,17-18H,11-13H2,1-8H3/t17-,18+/m0/s1 |
| InChIKey | ACWSMRRYOJZDGR-ZWKOTPCHSA-N |
| XLogP | 2.80 |
| TPSA | 80.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|