About dipotassium;4-(oxomethyl)benzoate;hydroxide
dipotassium;4-(oxomethyl)benzoate;hydroxide (PubChem CID 153494101) has the molecular formula C8H5K2O4-
and a molecular weight of 243.32 g/mol. Its IUPAC name is dipotassium;4-(oxomethyl)benzoate;hydroxide.
Molecular Properties
| Compound Name | dipotassium;4-(oxomethyl)benzoate;hydroxide |
| PubChem CID | 153494101 |
| Molecular Formula | C8H5K2O4- |
| Molecular Weight | 243.32 g/mol |
| Exact Mass | 242.95 |
| IUPAC Name | dipotassium;4-(oxomethyl)benzoate;hydroxide |
| SMILES | O=[C-]c1ccc(C(=O)[O-])cc1.[K+].[K+].[OH-] |
| InChI | InChI=1S/C8H5O3.2K.H2O/c9-5-6-1-3-7(4-2-6)8(10)11;;;/h1-4H,(H,10,11);;;1H2/q-1;2*+1;/p-2 |
| InChIKey | BIKYPNSXAJZQKK-UHFFFAOYSA-L |
| XLogP | -6.66 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.32 |
| LogP ≤ 5 | -6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;4-(oxomethyl)benzoate;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;4-(oxomethyl)benzoate;hydroxide?
The IUPAC name of dipotassium;4-(oxomethyl)benzoate;hydroxide (CID 153494101) is dipotassium;4-(oxomethyl)benzoate;hydroxide.
What is the SMILES notation for dipotassium;4-(oxomethyl)benzoate;hydroxide?
The canonical SMILES for dipotassium;4-(oxomethyl)benzoate;hydroxide is O=[C-]c1ccc(C(=O)[O-])cc1.[K+].[K+].[OH-].
What is the InChIKey of dipotassium;4-(oxomethyl)benzoate;hydroxide?
The InChIKey is BIKYPNSXAJZQKK-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H5O3.2K.H2O/c9-5-6-1-3-7(4-2-6)8(10)11;;;/h1-4H,(H,10,11);;;1H2/q-1;2*+1;/p-2.
What are the key properties of dipotassium;4-(oxomethyl)benzoate;hydroxide?
dipotassium;4-(oxomethyl)benzoate;hydroxide has a molecular weight of 243.32 g/mol, XLogP of -6.66, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;4-(oxomethyl)benzoate;hydroxide is sourced from PubChem (CID 153494101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).