About CID 153495304
CID 153495304 (PubChem CID 153495304) has the molecular formula C37H25BN5Pd-3
and a molecular weight of 656.87 g/mol.
Molecular Properties
| Compound Name | CID 153495304 |
| PubChem CID | 153495304 |
| Molecular Formula | C37H25BN5Pd-3 |
| Molecular Weight | 656.87 g/mol |
| Exact Mass | 656.13 |
| IUPAC Name | — |
| SMILES | Cn1ccnc1-c1[c-]c2c(cc1)-c1ccccc1B1c3ccccc3-c3ccc(N4C=CN(c5ccccc5)[CH-]4)[c-]c3N12.[Pd] |
| InChI | InChI=1S/C37H25BN5.Pd/c1-40-20-19-39-37(40)26-15-17-31-29-11-5-7-13-33(29)38-34-14-8-6-12-30(34)32-18-16-28(24-36(32)43(38)35(31)23-26)42-22-21-41(25-42)27-9-3-2-4-10-27;/h2-22,25H,1H3;/q-3; |
| InChIKey | YHEMFTGFDUPMCE-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 27.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 656.87 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 153495304 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153495304?
The IUPAC name of CID 153495304 (CID 153495304) is not available.
What is the SMILES notation for CID 153495304?
The canonical SMILES for CID 153495304 is Cn1ccnc1-c1[c-]c2c(cc1)-c1ccccc1B1c3ccccc3-c3ccc(N4C=CN(c5ccccc5)[CH-]4)[c-]c3N12.[Pd].
What is the InChIKey of CID 153495304?
The InChIKey is YHEMFTGFDUPMCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H25BN5.Pd/c1-40-20-19-39-37(40)26-15-17-31-29-11-5-7-13-33(29)38-34-14-8-6-12-30(34)32-18-16-28(24-36(32)43(38)35(31)23-26)42-22-21-41(25-42)27-9-3-2-4-10-27;/h2-22,25H,1H3;/q-3;.
What are the key properties of CID 153495304?
CID 153495304 has a molecular weight of 656.87 g/mol, XLogP of 6.51, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153495304 is sourced from PubChem (CID 153495304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).