C35H27BN4 — CID 153495311
4-(3,5-dimethylpyrazol-1-yl)-24-(4-methyl-2-pyridinyl)-1-aza-14-borahexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-2(7),3,5,8,10,12,15,17,19,21(26),22,24-dodecaene (PubChem CID 153495311) has the molecular formula C35H27BN4 and a molecular weight of 514.44 g/mol. Its IUPAC name is 4-(3,5-dimethylpyrazol-1-yl)-24-(4-methyl-2-pyridinyl)-1-aza-14-borahexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-2(7),3,5,8,10,12,15,17,19,21(26),22,24-dodecaene.
| Compound Name | 4-(3,5-dimethylpyrazol-1-yl)-24-(4-methyl-2-pyridinyl)-1-aza-14-borahexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-2(7),3,5,8,10,12,15,17,19,21(26),22,24-dodecaene |
|---|---|
| PubChem CID | 153495311 |
| Molecular Formula | C35H27BN4 |
| Molecular Weight | 514.44 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 4-(3,5-dimethylpyrazol-1-yl)-24-(4-methyl-2-pyridinyl)-1-aza-14-borahexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-2(7),3,5,8,10,12,15,17,19,21(26),22,24-dodecaene |
| SMILES | Cc1ccnc(-c2ccc3c(c2)N2B(c4ccccc4-3)c3ccccc3-c3ccc(-n4nc(C)cc4C)cc32)c1 |
| InChI | InChI=1S/C35H27BN4/c1-22-16-17-37-33(18-22)25-12-14-29-27-8-4-6-10-31(27)36-32-11-7-5-9-28(32)30-15-13-26(40-24(3)19-23(2)38-40)21-35(30)39(36)34(29)20-25/h4-21H,1-3H3 |
| InChIKey | GWMVBLULMLZXKU-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.44 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|