About CID 153495535
CID 153495535 (PubChem CID 153495535) has the molecular formula C38H27BN7Pt-3
and a molecular weight of 787.57 g/mol.
Molecular Properties
| Compound Name | CID 153495535 |
| PubChem CID | 153495535 |
| Molecular Formula | C38H27BN7Pt-3 |
| Molecular Weight | 787.57 g/mol |
| Exact Mass | 787.21 |
| IUPAC Name | — |
| SMILES | CN1[CH-]N(c2[c-]c3c(cc2)-c2ccccc2N2B3c3[c-]c(N4CN(C)c5ccccc54)ccc3-c3ccccc32)c2nccnc21.[Pt] |
| InChI | InChI=1S/C38H27BN7.Pt/c1-42-23-44(36-14-8-7-13-35(36)42)25-15-17-27-29-9-3-5-11-33(29)46-34-12-6-4-10-30(34)28-18-16-26(22-32(28)39(46)31(27)21-25)45-24-43(2)37-38(45)41-20-19-40-37;/h3-20,24H,23H2,1-2H3;/q-3; |
| InChIKey | GRFBABDJHWNIOJ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 41.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 787.57 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 153495535 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153495535?
The IUPAC name of CID 153495535 (CID 153495535) is not available.
What is the SMILES notation for CID 153495535?
The canonical SMILES for CID 153495535 is CN1[CH-]N(c2[c-]c3c(cc2)-c2ccccc2N2B3c3[c-]c(N4CN(C)c5ccccc54)ccc3-c3ccccc32)c2nccnc21.[Pt].
What is the InChIKey of CID 153495535?
The InChIKey is GRFBABDJHWNIOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H27BN7.Pt/c1-42-23-44(36-14-8-7-13-35(36)42)25-15-17-27-29-9-3-5-11-33(29)46-34-12-6-4-10-30(34)28-18-16-26(22-32(28)39(46)31(27)21-25)45-24-43(2)37-38(45)41-20-19-40-37;/h3-20,24H,23H2,1-2H3;/q-3;.
What are the key properties of CID 153495535?
CID 153495535 has a molecular weight of 787.57 g/mol, XLogP of 6.23, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153495535 is sourced from PubChem (CID 153495535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).