C23H30BN5O4 — CID 153496207
2-[6-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]spiro[3.3]heptan-2-yl]oxypyridine-3-carboxamide (PubChem CID 153496207) has the molecular formula C23H30BN5O4 and a molecular weight of 451.34 g/mol. Its IUPAC name is 2-[6-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]spiro[3.3]heptan-2-yl]oxypyridine-3-carboxamide.
| Compound Name | 2-[6-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]spiro[3.3]heptan-2-yl]oxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 153496207 |
| Molecular Formula | C23H30BN5O4 |
| Molecular Weight | 451.34 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 2-[6-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]spiro[3.3]heptan-2-yl]oxypyridine-3-carboxamide |
| SMILES | CC1(C)OB(c2cnc(NC3CC4(C3)CC(Oc3ncccc3C(N)=O)C4)nc2)OC1(C)C |
| InChI | InChI=1S/C23H30BN5O4/c1-21(2)22(3,4)33-24(32-21)14-12-27-20(28-13-14)29-15-8-23(9-15)10-16(11-23)31-19-17(18(25)30)6-5-7-26-19/h5-7,12-13,15-16H,8-11H2,1-4H3,(H2,25,30)(H,27,28,29) |
| InChIKey | LRBRBQCCUWDAIZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 121.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|