C10H19BN2O2 — CID 153496579
2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dihydropyrazole (PubChem CID 153496579) has the molecular formula C10H19BN2O2 and a molecular weight of 210.09 g/mol. Its IUPAC name is 2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dihydropyrazole.
| Compound Name | 2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dihydropyrazole |
|---|---|
| PubChem CID | 153496579 |
| Molecular Formula | C10H19BN2O2 |
| Molecular Weight | 210.09 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dihydropyrazole |
| SMILES | CN1CC(B2OC(C)(C)C(C)(C)O2)=CN1 |
| InChI | InChI=1S/C10H19BN2O2/c1-9(2)10(3,4)15-11(14-9)8-6-12-13(5)7-8/h6,12H,7H2,1-5H3 |
| InChIKey | YCDNKIFMEVFEDW-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.09 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|