About pentakis(rutherfordium);1,2,2-trifluoroethenol
pentakis(rutherfordium);1,2,2-trifluoroethenol (PubChem CID 153496854) has the molecular formula C2HF3ORf5
and a molecular weight of 1433.02 g/mol. Its IUPAC name is pentakis(rutherfordium);1,2,2-trifluoroethenol.
Molecular Properties
| Compound Name | pentakis(rutherfordium);1,2,2-trifluoroethenol |
| PubChem CID | 153496854 |
| Molecular Formula | C2HF3ORf5 |
| Molecular Weight | 1433.02 g/mol |
| Exact Mass | 1433.61 |
| IUPAC Name | pentakis(rutherfordium);1,2,2-trifluoroethenol |
| SMILES | OC(F)=C(F)F.[Rf].[Rf].[Rf].[Rf].[Rf] |
| InChI | InChI=1S/C2HF3O.5Rf/c3-1(4)2(5)6;;;;;/h6H;;;;; |
| InChIKey | NTKCDTANJOFXIH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 1433.02 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze pentakis(rutherfordium);1,2,2-trifluoroethenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentakis(rutherfordium);1,2,2-trifluoroethenol?
The IUPAC name of pentakis(rutherfordium);1,2,2-trifluoroethenol (CID 153496854) is pentakis(rutherfordium);1,2,2-trifluoroethenol.
What is the SMILES notation for pentakis(rutherfordium);1,2,2-trifluoroethenol?
The canonical SMILES for pentakis(rutherfordium);1,2,2-trifluoroethenol is OC(F)=C(F)F.[Rf].[Rf].[Rf].[Rf].[Rf].
What is the InChIKey of pentakis(rutherfordium);1,2,2-trifluoroethenol?
The InChIKey is NTKCDTANJOFXIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C2HF3O.5Rf/c3-1(4)2(5)6;;;;;/h6H;;;;;.
What are the key properties of pentakis(rutherfordium);1,2,2-trifluoroethenol?
pentakis(rutherfordium);1,2,2-trifluoroethenol has a molecular weight of 1433.02 g/mol, XLogP of 1.58, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentakis(rutherfordium);1,2,2-trifluoroethenol is sourced from PubChem (CID 153496854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).