About 5-amino-2-[1,4,4-tris(4-amino-2-hydroxyphenyl)cyclohexyl]phenol
5-amino-2-[1,4,4-tris(4-amino-2-hydroxyphenyl)cyclohexyl]phenol (PubChem CID 153497972) has the molecular formula C30H32N4O4
and a molecular weight of 512.61 g/mol. Its IUPAC name is 5-amino-2-[1,4,4-tris(4-amino-2-hydroxyphenyl)cyclohexyl]phenol.
Molecular Properties
| Compound Name | 5-amino-2-[1,4,4-tris(4-amino-2-hydroxyphenyl)cyclohexyl]phenol |
| PubChem CID | 153497972 |
| Molecular Formula | C30H32N4O4 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | 5-amino-2-[1,4,4-tris(4-amino-2-hydroxyphenyl)cyclohexyl]phenol |
| SMILES | Nc1ccc(C2(c3ccc(N)cc3O)CCC(c3ccc(N)cc3O)(c3ccc(N)cc3O)CC2)c(O)c1 |
| InChI | InChI=1S/C30H32N4O4/c31-17-1-5-21(25(35)13-17)29(22-6-2-18(32)14-26(22)36)9-11-30(12-10-29,23-7-3-19(33)15-27(23)37)24-8-4-20(34)16-28(24)38/h1-8,13-16,35-38H,9-12,31-34H2 |
| InChIKey | ZGQBREZZKIMRKU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 185.00 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-[1,4,4-tris(4-amino-2-hydroxyphenyl)cyclohexyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-[1,4,4-tris(4-amino-2-hydroxyphenyl)cyclohexyl]phenol?
The IUPAC name of 5-amino-2-[1,4,4-tris(4-amino-2-hydroxyphenyl)cyclohexyl]phenol (CID 153497972) is 5-amino-2-[1,4,4-tris(4-amino-2-hydroxyphenyl)cyclohexyl]phenol.
What is the SMILES notation for 5-amino-2-[1,4,4-tris(4-amino-2-hydroxyphenyl)cyclohexyl]phenol?
The canonical SMILES for 5-amino-2-[1,4,4-tris(4-amino-2-hydroxyphenyl)cyclohexyl]phenol is Nc1ccc(C2(c3ccc(N)cc3O)CCC(c3ccc(N)cc3O)(c3ccc(N)cc3O)CC2)c(O)c1.
What is the InChIKey of 5-amino-2-[1,4,4-tris(4-amino-2-hydroxyphenyl)cyclohexyl]phenol?
The InChIKey is ZGQBREZZKIMRKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H32N4O4/c31-17-1-5-21(25(35)13-17)29(22-6-2-18(32)14-26(22)36)9-11-30(12-10-29,23-7-3-19(33)15-27(23)37)24-8-4-20(34)16-28(24)38/h1-8,13-16,35-38H,9-12,31-34H2.
What are the key properties of 5-amino-2-[1,4,4-tris(4-amino-2-hydroxyphenyl)cyclohexyl]phenol?
5-amino-2-[1,4,4-tris(4-amino-2-hydroxyphenyl)cyclohexyl]phenol has a molecular weight of 512.61 g/mol, XLogP of 4.68, 4 rotatable bonds, 8 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-[1,4,4-tris(4-amino-2-hydroxyphenyl)cyclohexyl]phenol is sourced from PubChem (CID 153497972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).