C37H30BFN2O2S — CID 153498030
N-(4-fluorophenyl)-N-(3-isocyanophenyl)-4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]dibenzothiophen-2-amine (PubChem CID 153498030) has the molecular formula C37H30BFN2O2S and a molecular weight of 596.54 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N-(3-isocyanophenyl)-4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]dibenzothiophen-2-amine.
| Compound Name | N-(4-fluorophenyl)-N-(3-isocyanophenyl)-4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]dibenzothiophen-2-amine |
|---|---|
| PubChem CID | 153498030 |
| Molecular Formula | C37H30BFN2O2S |
| Molecular Weight | 596.54 g/mol |
| Exact Mass | 596.21 |
| IUPAC Name | N-(4-fluorophenyl)-N-(3-isocyanophenyl)-4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]dibenzothiophen-2-amine |
| SMILES | [C-]#[N+]c1cccc(N(c2ccc(F)cc2)c2cc(-c3ccccc3B3OC(C)(C)C(C)(C)O3)c3sc4ccccc4c3c2)c1 |
| InChI | InChI=1S/C37H30BFN2O2S/c1-36(2)37(3,4)43-38(42-36)33-15-8-6-13-29(33)31-22-28(23-32-30-14-7-9-16-34(30)44-35(31)32)41(26-19-17-24(39)18-20-26)27-12-10-11-25(21-27)40-5/h6-23H,1-4H3 |
| InChIKey | YOHXGZCKIYAMCJ-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 26.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.54 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|