C57H57BN2 — CID 153498154
4,12-ditert-butyl-8-(4-tert-butylphenyl)-18-(3-carbazol-9-ylphenyl)-14,14-dimethyl-8-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene (PubChem CID 153498154) has the molecular formula C57H57BN2 and a molecular weight of 780.91 g/mol. Its IUPAC name is 4,12-ditert-butyl-8-(4-tert-butylphenyl)-18-(3-carbazol-9-ylphenyl)-14,14-dimethyl-8-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene.
| Compound Name | 4,12-ditert-butyl-8-(4-tert-butylphenyl)-18-(3-carbazol-9-ylphenyl)-14,14-dimethyl-8-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene |
|---|---|
| PubChem CID | 153498154 |
| Molecular Formula | C57H57BN2 |
| Molecular Weight | 780.91 g/mol |
| Exact Mass | 780.46 |
| IUPAC Name | 4,12-ditert-butyl-8-(4-tert-butylphenyl)-18-(3-carbazol-9-ylphenyl)-14,14-dimethyl-8-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene |
| SMILES | CC(C)(C)c1ccc(N2c3ccc(C(C)(C)C)cc3B3c4cc(-c5cccc(-n6c7ccccc7c7ccccc76)c5)ccc4C(C)(C)c4c(C(C)(C)C)ccc2c43)cc1 |
| InChI | InChI=1S/C57H57BN2/c1-54(2,3)38-24-27-40(28-25-38)59-50-31-26-39(55(4,5)6)35-47(50)58-46-34-37(23-29-44(46)57(10,11)52-45(56(7,8)9)30-32-51(59)53(52)58)36-17-16-18-41(33-36)60-48-21-14-12-19-42(48)43-20-13-15-22-49(43)60/h12-35H,1-11H3 |
| InChIKey | VIPRCPUXEMFRCL-UHFFFAOYSA-N |
| XLogP | 13.28 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.91 |
| LogP ≤ 5 | 13.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|