C17H20BN3O2 — CID 153498763
2-(1-methylpyrazol-4-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (PubChem CID 153498763) has the molecular formula C17H20BN3O2 and a molecular weight of 309.18 g/mol. Its IUPAC name is 2-(1-methylpyrazol-4-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile.
| Compound Name | 2-(1-methylpyrazol-4-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 153498763 |
| Molecular Formula | C17H20BN3O2 |
| Molecular Weight | 309.18 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-(1-methylpyrazol-4-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| SMILES | Cn1cc(-c2cccc(B3OC(C)(C)C(C)(C)O3)c2C#N)cn1 |
| InChI | InChI=1S/C17H20BN3O2/c1-16(2)17(3,4)23-18(22-16)15-8-6-7-13(14(15)9-19)12-10-20-21(5)11-12/h6-8,10-11H,1-5H3 |
| InChIKey | IEVBPQNBCYXLAP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.18 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|