About [4-(hydroxymethyl)cyclohexyl]methyl 2,2-dimethylpropanoate
[4-(hydroxymethyl)cyclohexyl]methyl 2,2-dimethylpropanoate (PubChem CID 15349892) has the molecular formula C13H24O3
and a molecular weight of 228.33 g/mol. Its IUPAC name is [4-(hydroxymethyl)cyclohexyl]methyl 2,2-dimethylpropanoate.
Analyze [4-(hydroxymethyl)cyclohexyl]methyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(hydroxymethyl)cyclohexyl]methyl 2,2-dimethylpropanoate?
The IUPAC name of [4-(hydroxymethyl)cyclohexyl]methyl 2,2-dimethylpropanoate (CID 15349892) is [4-(hydroxymethyl)cyclohexyl]methyl 2,2-dimethylpropanoate.
What is the SMILES notation for [4-(hydroxymethyl)cyclohexyl]methyl 2,2-dimethylpropanoate?
The canonical SMILES for [4-(hydroxymethyl)cyclohexyl]methyl 2,2-dimethylpropanoate is CC(C)(C)C(=O)OCC1CCC(CO)CC1.
What is the InChIKey of [4-(hydroxymethyl)cyclohexyl]methyl 2,2-dimethylpropanoate?
The InChIKey is YBVUKYHNYMSBHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O3/c1-13(2,3)12(15)16-9-11-6-4-10(8-14)5-7-11/h10-11,14H,4-9H2,1-3H3.
What are the key properties of [4-(hydroxymethyl)cyclohexyl]methyl 2,2-dimethylpropanoate?
[4-(hydroxymethyl)cyclohexyl]methyl 2,2-dimethylpropanoate has a molecular weight of 228.33 g/mol, XLogP of 2.37, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(hydroxymethyl)cyclohexyl]methyl 2,2-dimethylpropanoate is sourced from PubChem (CID 15349892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).