C10H17NO — CID 153499463
(4E,6Z)-1-(methylamino)nona-4,6,8-trien-1-ol (PubChem CID 153499463) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (4E,6Z)-1-(methylamino)nona-4,6,8-trien-1-ol.
| Compound Name | (4E,6Z)-1-(methylamino)nona-4,6,8-trien-1-ol |
|---|---|
| PubChem CID | 153499463 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (4E,6Z)-1-(methylamino)nona-4,6,8-trien-1-ol |
| SMILES | C=C/C=C\C=C\CCC(O)NC |
| InChI | InChI=1S/C10H17NO/c1-3-4-5-6-7-8-9-10(12)11-2/h3-7,10-12H,1,8-9H2,2H3/b5-4-,7-6+ |
| InChIKey | BBJIWJSZOHXXGR-SCFJQAPRSA-N |
| XLogP | 1.60 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|