C20H19ClFN3O3S2 — CID 153499758
6-[5-(6-chloro-3-pyridinyl)-5-fluoro-4H-1,2-thiazol-3-yl]-1'-ethylsulfonylspiro[1H-2-benzofuran-3,3'-azetidine] (PubChem CID 153499758) has the molecular formula C20H19ClFN3O3S2 and a molecular weight of 467.98 g/mol. Its IUPAC name is 6-[5-(6-chloro-3-pyridinyl)-5-fluoro-4H-1,2-thiazol-3-yl]-1'-ethylsulfonylspiro[1H-2-benzofuran-3,3'-azetidine].
| Compound Name | 6-[5-(6-chloro-3-pyridinyl)-5-fluoro-4H-1,2-thiazol-3-yl]-1'-ethylsulfonylspiro[1H-2-benzofuran-3,3'-azetidine] |
|---|---|
| PubChem CID | 153499758 |
| Molecular Formula | C20H19ClFN3O3S2 |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | 6-[5-(6-chloro-3-pyridinyl)-5-fluoro-4H-1,2-thiazol-3-yl]-1'-ethylsulfonylspiro[1H-2-benzofuran-3,3'-azetidine] |
| SMILES | CCS(=O)(=O)N1CC2(C1)OCc1cc(C3=NSC(F)(c4ccc(Cl)nc4)C3)ccc12 |
| InChI | InChI=1S/C20H19ClFN3O3S2/c1-2-30(26,27)25-11-19(12-25)16-5-3-13(7-14(16)10-28-19)17-8-20(22,29-24-17)15-4-6-18(21)23-9-15/h3-7,9H,2,8,10-12H2,1H3 |
| InChIKey | PREPVFSLDBQXRA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 71.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|