C22H17F5 — CID 153499802
5-[(3,5-difluoro-4-methylphenyl)-(3-fluoro-4-methylphenyl)methyl]-1,3-difluoro-2-methylbenzene (PubChem CID 153499802) has the molecular formula C22H17F5 and a molecular weight of 376.37 g/mol. Its IUPAC name is 5-[(3,5-difluoro-4-methylphenyl)-(3-fluoro-4-methylphenyl)methyl]-1,3-difluoro-2-methylbenzene.
| Compound Name | 5-[(3,5-difluoro-4-methylphenyl)-(3-fluoro-4-methylphenyl)methyl]-1,3-difluoro-2-methylbenzene |
|---|---|
| PubChem CID | 153499802 |
| Molecular Formula | C22H17F5 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 5-[(3,5-difluoro-4-methylphenyl)-(3-fluoro-4-methylphenyl)methyl]-1,3-difluoro-2-methylbenzene |
| SMILES | Cc1ccc(C(c2cc(F)c(C)c(F)c2)c2cc(F)c(C)c(F)c2)cc1F |
| InChI | InChI=1S/C22H17F5/c1-11-4-5-14(6-17(11)23)22(15-7-18(24)12(2)19(25)8-15)16-9-20(26)13(3)21(27)10-16/h4-10,22H,1-3H3 |
| InChIKey | YIQIXSQBKXKXGX-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|