C34H41B2F2NO4 — CID 153499804
9-(4-butylphenyl)-1,8-difluoro-3,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole (PubChem CID 153499804) has the molecular formula C34H41B2F2NO4 and a molecular weight of 587.33 g/mol. Its IUPAC name is 9-(4-butylphenyl)-1,8-difluoro-3,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole.
| Compound Name | 9-(4-butylphenyl)-1,8-difluoro-3,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
|---|---|
| PubChem CID | 153499804 |
| Molecular Formula | C34H41B2F2NO4 |
| Molecular Weight | 587.33 g/mol |
| Exact Mass | 587.32 |
| IUPAC Name | 9-(4-butylphenyl)-1,8-difluoro-3,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
| SMILES | CCCCc1ccc(-n2c3c(F)cc(B4OC(C)(C)C(C)(C)O4)cc3c3cc(B4OC(C)(C)C(C)(C)O4)cc(F)c32)cc1 |
| InChI | InChI=1S/C34H41B2F2NO4/c1-10-11-12-21-13-15-24(16-14-21)39-29-25(17-22(19-27(29)37)35-40-31(2,3)32(4,5)41-35)26-18-23(20-28(38)30(26)39)36-42-33(6,7)34(8,9)43-36/h13-20H,10-12H2,1-9H3 |
| InChIKey | RIZRVWMJSZUIHO-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 41.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.33 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|