About 4-(4-tert-butylcyclohexyl)-5,5-dimethylhexanenitrile
4-(4-tert-butylcyclohexyl)-5,5-dimethylhexanenitrile (PubChem CID 153499914) has the molecular formula C18H33N
and a molecular weight of 263.47 g/mol. Its IUPAC name is 4-(4-tert-butylcyclohexyl)-5,5-dimethylhexanenitrile.
Molecular Properties
| Compound Name | 4-(4-tert-butylcyclohexyl)-5,5-dimethylhexanenitrile |
| PubChem CID | 153499914 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | 4-(4-tert-butylcyclohexyl)-5,5-dimethylhexanenitrile |
| SMILES | CC(C)(C)C1CCC(C(CCC#N)C(C)(C)C)CC1 |
| InChI | InChI=1S/C18H33N/c1-17(2,3)15-11-9-14(10-12-15)16(8-7-13-19)18(4,5)6/h14-16H,7-12H2,1-6H3 |
| InChIKey | JNHACBBNFYDIMW-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(4-tert-butylcyclohexyl)-5,5-dimethylhexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-tert-butylcyclohexyl)-5,5-dimethylhexanenitrile?
The IUPAC name of 4-(4-tert-butylcyclohexyl)-5,5-dimethylhexanenitrile (CID 153499914) is 4-(4-tert-butylcyclohexyl)-5,5-dimethylhexanenitrile.
What is the SMILES notation for 4-(4-tert-butylcyclohexyl)-5,5-dimethylhexanenitrile?
The canonical SMILES for 4-(4-tert-butylcyclohexyl)-5,5-dimethylhexanenitrile is CC(C)(C)C1CCC(C(CCC#N)C(C)(C)C)CC1.
What is the InChIKey of 4-(4-tert-butylcyclohexyl)-5,5-dimethylhexanenitrile?
The InChIKey is JNHACBBNFYDIMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33N/c1-17(2,3)15-11-9-14(10-12-15)16(8-7-13-19)18(4,5)6/h14-16H,7-12H2,1-6H3.
What are the key properties of 4-(4-tert-butylcyclohexyl)-5,5-dimethylhexanenitrile?
4-(4-tert-butylcyclohexyl)-5,5-dimethylhexanenitrile has a molecular weight of 263.47 g/mol, XLogP of 5.80, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-tert-butylcyclohexyl)-5,5-dimethylhexanenitrile is sourced from PubChem (CID 153499914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).