About 1-(5,7-dibromo-1-benzofuran-2-yl)propan-1-ol
1-(5,7-dibromo-1-benzofuran-2-yl)propan-1-ol (PubChem CID 15350188) has the molecular formula C11H10Br2O2
and a molecular weight of 334.01 g/mol. Its IUPAC name is 1-(5,7-dibromo-1-benzofuran-2-yl)propan-1-ol.
Molecular Properties
| Compound Name | 1-(5,7-dibromo-1-benzofuran-2-yl)propan-1-ol |
| PubChem CID | 15350188 |
| Molecular Formula | C11H10Br2O2 |
| Molecular Weight | 334.01 g/mol |
| Exact Mass | 331.90 |
| IUPAC Name | 1-(5,7-dibromo-1-benzofuran-2-yl)propan-1-ol |
| SMILES | CCC(O)c1cc2cc(Br)cc(Br)c2o1 |
| InChI | InChI=1S/C11H10Br2O2/c1-2-9(14)10-4-6-3-7(12)5-8(13)11(6)15-10/h3-5,9,14H,2H2,1H3 |
| InChIKey | QLYBPCAPZJERDI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.01 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5,7-dibromo-1-benzofuran-2-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,7-dibromo-1-benzofuran-2-yl)propan-1-ol?
The IUPAC name of 1-(5,7-dibromo-1-benzofuran-2-yl)propan-1-ol (CID 15350188) is 1-(5,7-dibromo-1-benzofuran-2-yl)propan-1-ol.
What is the SMILES notation for 1-(5,7-dibromo-1-benzofuran-2-yl)propan-1-ol?
The canonical SMILES for 1-(5,7-dibromo-1-benzofuran-2-yl)propan-1-ol is CCC(O)c1cc2cc(Br)cc(Br)c2o1.
What is the InChIKey of 1-(5,7-dibromo-1-benzofuran-2-yl)propan-1-ol?
The InChIKey is QLYBPCAPZJERDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Br2O2/c1-2-9(14)10-4-6-3-7(12)5-8(13)11(6)15-10/h3-5,9,14H,2H2,1H3.
What are the key properties of 1-(5,7-dibromo-1-benzofuran-2-yl)propan-1-ol?
1-(5,7-dibromo-1-benzofuran-2-yl)propan-1-ol has a molecular weight of 334.01 g/mol, XLogP of 4.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,7-dibromo-1-benzofuran-2-yl)propan-1-ol is sourced from PubChem (CID 15350188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).