C17H21NO4 — CID 15350331
ethyl (2R,3R,3aR)-3-benzoyl-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine-2-carboxylate (PubChem CID 15350331) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is ethyl (2R,3R,3aR)-3-benzoyl-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine-2-carboxylate.
| Compound Name | ethyl (2R,3R,3aR)-3-benzoyl-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 15350331 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | ethyl (2R,3R,3aR)-3-benzoyl-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1ON2CCCC[C@@H]2[C@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H21NO4/c1-2-21-17(20)16-14(13-10-6-7-11-18(13)22-16)15(19)12-8-4-3-5-9-12/h3-5,8-9,13-14,16H,2,6-7,10-11H2,1H3/t13-,14+,16-/m1/s1 |
| InChIKey | OLSRKERSLWQXBN-IJEWVQPXSA-N |
| XLogP | 2.22 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |