About 4-(Hydroxymethyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one
4-(Hydroxymethyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 15350346) has the molecular formula C11H12O2
and a molecular weight of 176.21 g/mol. Its IUPAC name is 4-(hydroxymethyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
Molecular Properties
| Compound Name | 4-(Hydroxymethyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| PubChem CID | 15350346 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 4-(hydroxymethyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | C1C2C=CC1C3C2C=C(C3=O)CO |
| InChI | InChI=1S/C11H12O2/c12-5-8-4-9-6-1-2-7(3-6)10(9)11(8)13/h1-2,4,6-7,9-10,12H,3,5H2 |
| InChIKey | RFOGNILKHXAVHA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | 327 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(Hydroxymethyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(Hydroxymethyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one?
The IUPAC name of 4-(Hydroxymethyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one (CID 15350346) is 4-(hydroxymethyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
What is the SMILES notation for 4-(Hydroxymethyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one?
The canonical SMILES for 4-(Hydroxymethyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one is C1C2C=CC1C3C2C=C(C3=O)CO.
What is the InChIKey of 4-(Hydroxymethyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one?
The InChIKey is RFOGNILKHXAVHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2/c12-5-8-4-9-6-1-2-7(3-6)10(9)11(8)13/h1-2,4,6-7,9-10,12H,3,5H2.
What are the key properties of 4-(Hydroxymethyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one?
4-(Hydroxymethyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one has a molecular weight of 176.21 g/mol, XLogP of 1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(Hydroxymethyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one is sourced from PubChem (CID 15350346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).