C15H30O4Si — CID 15350448
(4S)-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2-dimethyl-1,3-dioxan-5-one (PubChem CID 15350448) has the molecular formula C15H30O4Si and a molecular weight of 302.49 g/mol. Its IUPAC name is (4S)-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2-dimethyl-1,3-dioxan-5-one.
| Compound Name | (4S)-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2-dimethyl-1,3-dioxan-5-one |
|---|---|
| PubChem CID | 15350448 |
| Molecular Formula | C15H30O4Si |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (4S)-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2-dimethyl-1,3-dioxan-5-one |
| SMILES | CC1(C)OCC(=O)[C@H](CCCO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C15H30O4Si/c1-14(2,3)20(6,7)18-10-8-9-13-12(16)11-17-15(4,5)19-13/h13H,8-11H2,1-7H3/t13-/m0/s1 |
| InChIKey | SMAQLAIRDDFESC-ZDUSSCGKSA-N |
| XLogP | 3.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|