About CID 15350639
CID 15350639 (PubChem CID 15350639) has the molecular formula C46H53GeOSi
and a molecular weight of 722.63 g/mol.
Molecular Properties
| Compound Name | CID 15350639 |
| PubChem CID | 15350639 |
| Molecular Formula | C46H53GeOSi |
| Molecular Weight | 722.63 g/mol |
| Exact Mass | 723.31 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c([Ge]c2c(C)cc(C)cc2C)c(C)c1.Cc1cc(C)c([Si](O/C=C\C=C\c2ccccc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C28H31OSi.C18H22Ge/c1-20-16-22(3)27(23(4)17-20)30(28-24(5)18-21(2)19-25(28)6)29-15-11-10-14-26-12-8-7-9-13-26;1-11-7-13(3)17(14(4)8-11)19-18-15(5)9-12(2)10-16(18)6/h7-19H,1-6H3;7-10H,1-6H3/b14-10+,15-11-; |
| InChIKey | NDRYHWWPWNCZQV-XWSDGJATSA-N |
| XLogP | 9.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 722.63 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze CID 15350639 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 15350639?
The IUPAC name of CID 15350639 (CID 15350639) is not available.
What is the SMILES notation for CID 15350639?
The canonical SMILES for CID 15350639 is Cc1cc(C)c([Ge]c2c(C)cc(C)cc2C)c(C)c1.Cc1cc(C)c([Si](O/C=C\C=C\c2ccccc2)c2c(C)cc(C)cc2C)c(C)c1.
What is the InChIKey of CID 15350639?
The InChIKey is NDRYHWWPWNCZQV-XWSDGJATSA-N. The full InChI is InChI=1S/C28H31OSi.C18H22Ge/c1-20-16-22(3)27(23(4)17-20)30(28-24(5)18-21(2)19-25(28)6)29-15-11-10-14-26-12-8-7-9-13-26;1-11-7-13(3)17(14(4)8-11)19-18-15(5)9-12(2)10-16(18)6/h7-19H,1-6H3;7-10H,1-6H3/b14-10+,15-11-;.
What are the key properties of CID 15350639?
CID 15350639 has a molecular weight of 722.63 g/mol, XLogP of 9.08, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 15350639 is sourced from PubChem (CID 15350639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).