C20H20O4 — CID 15350785
(3aR,4S,9bR)-7,7-dimethyl-4-phenyl-3a,4,5,6,8,9b-hexahydrobenzo[e][2]benzofuran-1,3,9-trione (PubChem CID 15350785) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is (3aR,4S,9bR)-7,7-dimethyl-4-phenyl-3a,4,5,6,8,9b-hexahydrobenzo[e][2]benzofuran-1,3,9-trione.
| Compound Name | (3aR,4S,9bR)-7,7-dimethyl-4-phenyl-3a,4,5,6,8,9b-hexahydrobenzo[e][2]benzofuran-1,3,9-trione |
|---|---|
| PubChem CID | 15350785 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (3aR,4S,9bR)-7,7-dimethyl-4-phenyl-3a,4,5,6,8,9b-hexahydrobenzo[e][2]benzofuran-1,3,9-trione |
| SMILES | CC1(C)CC(=O)C2=C(C[C@H](c3ccccc3)[C@H]3C(=O)OC(=O)[C@@H]23)C1 |
| InChI | InChI=1S/C20H20O4/c1-20(2)9-12-8-13(11-6-4-3-5-7-11)16-17(15(12)14(21)10-20)19(23)24-18(16)22/h3-7,13,16-17H,8-10H2,1-2H3/t13-,16-,17+/m1/s1 |
| InChIKey | WZBSGALIEPXJLR-XYPHTWIQSA-N |
| XLogP | 3.18 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|