C16H11ClN2O3 — CID 15351189
5-(4-chlorophenyl)-2-(4-methoxyphenyl)pyrazole-3,4-dione (PubChem CID 15351189) has the molecular formula C16H11ClN2O3 and a molecular weight of 314.73 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-(4-methoxyphenyl)pyrazole-3,4-dione.
| Compound Name | 5-(4-chlorophenyl)-2-(4-methoxyphenyl)pyrazole-3,4-dione |
|---|---|
| PubChem CID | 15351189 |
| Molecular Formula | C16H11ClN2O3 |
| Molecular Weight | 314.73 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 5-(4-chlorophenyl)-2-(4-methoxyphenyl)pyrazole-3,4-dione |
| SMILES | COc1ccc(N2N=C(c3ccc(Cl)cc3)C(=O)C2=O)cc1 |
| InChI | InChI=1S/C16H11ClN2O3/c1-22-13-8-6-12(7-9-13)19-16(21)15(20)14(18-19)10-2-4-11(17)5-3-10/h2-9H,1H3 |
| InChIKey | KPAGKOCKOSDUSZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.73 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_fives(89)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|